C54H78O18 — CID 158933563
6-O-benzyl 1-O-[2-(2-methoxyethoxy)ethyl] hexanedioate;bis[2-(2-methoxyethoxy)ethyl] hexanedioate;dibenzyl hexanedioate (PubChem CID 158933563) has the molecular formula C54H78O18 and a molecular weight of 1015.20 g/mol. Its IUPAC name is 6-O-benzyl 1-O-[2-(2-methoxyethoxy)ethyl] hexanedioate;bis[2-(2-methoxyethoxy)ethyl] hexanedioate;dibenzyl hexanedioate.
| Compound Name | 6-O-benzyl 1-O-[2-(2-methoxyethoxy)ethyl] hexanedioate;bis[2-(2-methoxyethoxy)ethyl] hexanedioate;dibenzyl hexanedioate |
|---|---|
| PubChem CID | 158933563 |
| Molecular Formula | C54H78O18 |
| Molecular Weight | 1015.20 g/mol |
| Exact Mass | 1014.52 |
| IUPAC Name | 6-O-benzyl 1-O-[2-(2-methoxyethoxy)ethyl] hexanedioate;bis[2-(2-methoxyethoxy)ethyl] hexanedioate;dibenzyl hexanedioate |
| SMILES | COCCOCCOC(=O)CCCCC(=O)OCCOCCOC.COCCOCCOC(=O)CCCCC(=O)OCc1ccccc1.O=C(CCCCC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H22O4.C18H26O6.C16H30O8/c21-19(23-15-17-9-3-1-4-10-17)13-7-8-14-20(22)24-16-18-11-5-2-6-12-18;1-21-11-12-22-13-14-23-17(19)9-5-6-10-18(20)24-15-16-7-3-2-4-8-16;1-19-7-9-21-11-13-23-15(17)5-3-4-6-16(18)24-14-12-22-10-8-20-2/h1-6,9-12H,7-8,13-16H2;2-4,7-8H,5-6,9-15H2,1H3;3-14H2,1-2H3 |
| InChIKey | JJJFVTQATUOJBA-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.20 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|