About benzyl 12-oxotridecanoate
benzyl 12-oxotridecanoate (PubChem CID 21035822) has the molecular formula C20H30O3
and a molecular weight of 318.46 g/mol. Its IUPAC name is benzyl 12-oxotridecanoate.
Molecular Properties
| Compound Name | benzyl 12-oxotridecanoate |
| PubChem CID | 21035822 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | benzyl 12-oxotridecanoate |
| SMILES | CC(=O)CCCCCCCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30O3/c1-18(21)13-9-6-4-2-3-5-7-12-16-20(22)23-17-19-14-10-8-11-15-19/h8,10-11,14-15H,2-7,9,12-13,16-17H2,1H3 |
| InChIKey | FMDYHQMRZOAXAB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 12-oxotridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 12-oxotridecanoate?
The IUPAC name of benzyl 12-oxotridecanoate (CID 21035822) is benzyl 12-oxotridecanoate.
What is the SMILES notation for benzyl 12-oxotridecanoate?
The canonical SMILES for benzyl 12-oxotridecanoate is CC(=O)CCCCCCCCCCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 12-oxotridecanoate?
The InChIKey is FMDYHQMRZOAXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O3/c1-18(21)13-9-6-4-2-3-5-7-12-16-20(22)23-17-19-14-10-8-11-15-19/h8,10-11,14-15H,2-7,9,12-13,16-17H2,1H3.
What are the key properties of benzyl 12-oxotridecanoate?
benzyl 12-oxotridecanoate has a molecular weight of 318.46 g/mol, XLogP of 5.22, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 12-oxotridecanoate is sourced from PubChem (CID 21035822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).