About benzyl 4-phenylbutanoate
benzyl 4-phenylbutanoate (PubChem CID 11961623) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is benzyl 4-phenylbutanoate.
Molecular Properties
| Compound Name | benzyl 4-phenylbutanoate |
| PubChem CID | 11961623 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | benzyl 4-phenylbutanoate |
| SMILES | O=C(CCCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H18O2/c18-17(19-14-16-10-5-2-6-11-16)13-7-12-15-8-3-1-4-9-15/h1-6,8-11H,7,12-14H2 |
| InChIKey | CNUZXGDIRMXKJV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-phenylbutanoate?
The IUPAC name of benzyl 4-phenylbutanoate (CID 11961623) is benzyl 4-phenylbutanoate.
What is the SMILES notation for benzyl 4-phenylbutanoate?
The canonical SMILES for benzyl 4-phenylbutanoate is O=C(CCCc1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl 4-phenylbutanoate?
The InChIKey is CNUZXGDIRMXKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c18-17(19-14-16-10-5-2-6-11-16)13-7-12-15-8-3-1-4-9-15/h1-6,8-11H,7,12-14H2.
What are the key properties of benzyl 4-phenylbutanoate?
benzyl 4-phenylbutanoate has a molecular weight of 254.33 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-phenylbutanoate is sourced from PubChem (CID 11961623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).