About benzyl 4-thiophen-2-ylbutanoate
benzyl 4-thiophen-2-ylbutanoate (PubChem CID 78759392) has the molecular formula C15H16O2S
and a molecular weight of 260.36 g/mol. Its IUPAC name is benzyl 4-thiophen-2-ylbutanoate.
Molecular Properties
| Compound Name | benzyl 4-thiophen-2-ylbutanoate |
| PubChem CID | 78759392 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | benzyl 4-thiophen-2-ylbutanoate |
| SMILES | O=C(CCCc1cccs1)OCc1ccccc1 |
| InChI | InChI=1S/C15H16O2S/c16-15(10-4-8-14-9-5-11-18-14)17-12-13-6-2-1-3-7-13/h1-3,5-7,9,11H,4,8,10,12H2 |
| InChIKey | DBVBVPQZAZMPOH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 4-thiophen-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-thiophen-2-ylbutanoate?
The IUPAC name of benzyl 4-thiophen-2-ylbutanoate (CID 78759392) is benzyl 4-thiophen-2-ylbutanoate.
What is the SMILES notation for benzyl 4-thiophen-2-ylbutanoate?
The canonical SMILES for benzyl 4-thiophen-2-ylbutanoate is O=C(CCCc1cccs1)OCc1ccccc1.
What is the InChIKey of benzyl 4-thiophen-2-ylbutanoate?
The InChIKey is DBVBVPQZAZMPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2S/c16-15(10-4-8-14-9-5-11-18-14)17-12-13-6-2-1-3-7-13/h1-3,5-7,9,11H,4,8,10,12H2.
What are the key properties of benzyl 4-thiophen-2-ylbutanoate?
benzyl 4-thiophen-2-ylbutanoate has a molecular weight of 260.36 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-thiophen-2-ylbutanoate is sourced from PubChem (CID 78759392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).