About (2-fluorophenyl) 4-thiophen-2-ylbutanoate
(2-fluorophenyl) 4-thiophen-2-ylbutanoate (PubChem CID 78777100) has the molecular formula C14H13FO2S
and a molecular weight of 264.32 g/mol. Its IUPAC name is (2-fluorophenyl) 4-thiophen-2-ylbutanoate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 4-thiophen-2-ylbutanoate |
| PubChem CID | 78777100 |
| Molecular Formula | C14H13FO2S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (2-fluorophenyl) 4-thiophen-2-ylbutanoate |
| SMILES | O=C(CCCc1cccs1)Oc1ccccc1F |
| InChI | InChI=1S/C14H13FO2S/c15-12-7-1-2-8-13(12)17-14(16)9-3-5-11-6-4-10-18-11/h1-2,4,6-8,10H,3,5,9H2 |
| InChIKey | ZQWAAYCFRCHYDQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) 4-thiophen-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 4-thiophen-2-ylbutanoate?
The IUPAC name of (2-fluorophenyl) 4-thiophen-2-ylbutanoate (CID 78777100) is (2-fluorophenyl) 4-thiophen-2-ylbutanoate.
What is the SMILES notation for (2-fluorophenyl) 4-thiophen-2-ylbutanoate?
The canonical SMILES for (2-fluorophenyl) 4-thiophen-2-ylbutanoate is O=C(CCCc1cccs1)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) 4-thiophen-2-ylbutanoate?
The InChIKey is ZQWAAYCFRCHYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FO2S/c15-12-7-1-2-8-13(12)17-14(16)9-3-5-11-6-4-10-18-11/h1-2,4,6-8,10H,3,5,9H2.
What are the key properties of (2-fluorophenyl) 4-thiophen-2-ylbutanoate?
(2-fluorophenyl) 4-thiophen-2-ylbutanoate has a molecular weight of 264.32 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 4-thiophen-2-ylbutanoate is sourced from PubChem (CID 78777100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).