About bis(2-fluorophenyl) hexanedioate
bis(2-fluorophenyl) hexanedioate (PubChem CID 91704928) has the molecular formula C18H16F2O4
and a molecular weight of 334.32 g/mol. Its IUPAC name is bis(2-fluorophenyl) hexanedioate.
Molecular Properties
| Compound Name | bis(2-fluorophenyl) hexanedioate |
| PubChem CID | 91704928 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | bis(2-fluorophenyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)Oc1ccccc1F)Oc1ccccc1F |
| InChI | InChI=1S/C18H16F2O4/c19-13-7-1-3-9-15(13)23-17(21)11-5-6-12-18(22)24-16-10-4-2-8-14(16)20/h1-4,7-10H,5-6,11-12H2 |
| InChIKey | BZBMOALOMPQAHK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(2-fluorophenyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-fluorophenyl) hexanedioate?
The IUPAC name of bis(2-fluorophenyl) hexanedioate (CID 91704928) is bis(2-fluorophenyl) hexanedioate.
What is the SMILES notation for bis(2-fluorophenyl) hexanedioate?
The canonical SMILES for bis(2-fluorophenyl) hexanedioate is O=C(CCCCC(=O)Oc1ccccc1F)Oc1ccccc1F.
What is the InChIKey of bis(2-fluorophenyl) hexanedioate?
The InChIKey is BZBMOALOMPQAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2O4/c19-13-7-1-3-9-15(13)23-17(21)11-5-6-12-18(22)24-16-10-4-2-8-14(16)20/h1-4,7-10H,5-6,11-12H2.
What are the key properties of bis(2-fluorophenyl) hexanedioate?
bis(2-fluorophenyl) hexanedioate has a molecular weight of 334.32 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-fluorophenyl) hexanedioate is sourced from PubChem (CID 91704928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).