C15H15F2NO2S — CID 78770266
N-[2-(difluoromethoxy)phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 78770266) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 78770266 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H15F2NO2S/c16-15(17)20-13-8-2-1-7-12(13)18-14(19)9-3-5-11-6-4-10-21-11/h1-2,4,6-8,10,15H,3,5,9H2,(H,18,19) |
| InChIKey | OVGABVKUKUNSEA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |