C18H21NO4S — CID 7962812
[2-(2-ethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate (PubChem CID 7962812) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962812 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C18H21NO4S/c1-2-22-16-10-4-3-9-15(16)19-17(20)13-23-18(21)11-5-7-14-8-6-12-24-14/h3-4,6,8-10,12H,2,5,7,11,13H2,1H3,(H,19,20) |
| InChIKey | LCSQYNZWAJQZMC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |