C18H21NO5S — CID 7962482
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate (PubChem CID 7962482) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962482 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C18H21NO5S/c1-22-13-8-9-15(16(11-13)23-2)19-17(20)12-24-18(21)7-3-5-14-6-4-10-25-14/h4,6,8-11H,3,5,7,12H2,1-2H3,(H,19,20) |
| InChIKey | FPYYFCCCTAYXCM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |