C22H24N2O5 — CID 7958497
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 7958497) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7958497 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCCc2c[nH]c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O5/c1-27-16-10-11-19(20(12-16)28-2)24-21(25)14-29-22(26)9-5-6-15-13-23-18-8-4-3-7-17(15)18/h3-4,7-8,10-13,23H,5-6,9,14H2,1-2H3,(H,24,25) |
| InChIKey | PFGBRGDNDWNTAR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |