C20H18Cl2N2O3 — CID 2434282
[2-(2,3-dichloroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 2434282) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 2434282 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1c[nH]c2ccccc12)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H18Cl2N2O3/c21-15-7-4-9-17(20(15)22)24-18(25)12-27-19(26)10-3-5-13-11-23-16-8-2-1-6-14(13)16/h1-2,4,6-9,11,23H,3,5,10,12H2,(H,24,25) |
| InChIKey | MAQNZDOEFAMOIK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |