C19H18ClN3O3 — CID 7541618
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 7541618) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7541618 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1c[nH]c2ccccc12)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C19H18ClN3O3/c20-14-8-9-17(22-11-14)23-18(24)12-26-19(25)7-3-4-13-10-21-16-6-2-1-5-15(13)16/h1-2,5-6,8-11,21H,3-4,7,12H2,(H,22,23,24) |
| InChIKey | TWCXUGPUSVFAAO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |