C20H18FN3O5 — CID 3466993
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 3466993) has the molecular formula C20H18FN3O5 and a molecular weight of 399.38 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 3466993 |
| Molecular Formula | C20H18FN3O5 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1c[nH]c2ccccc12)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18FN3O5/c21-16-9-8-14(10-18(16)24(27)28)23-19(25)12-29-20(26)7-3-4-13-11-22-17-6-2-1-5-15(13)17/h1-2,5-6,8-11,22H,3-4,7,12H2,(H,23,25) |
| InChIKey | OOAHVQHGOXNXOJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|