C22H23FN2O3 — CID 41427385
[2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 41427385) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 41427385 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [2-[(3-fluoro-4-methylphenyl)methylamino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | Cc1ccc(CNC(=O)COC(=O)CCCc2c[nH]c3ccccc23)cc1F |
| InChI | InChI=1S/C22H23FN2O3/c1-15-9-10-16(11-19(15)23)12-25-21(26)14-28-22(27)8-4-5-17-13-24-20-7-3-2-6-18(17)20/h2-3,6-7,9-11,13,24H,4-5,8,12,14H2,1H3,(H,25,26) |
| InChIKey | LCICPAYVIKCYKQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |