C19H25N3O4 — CID 9016665
[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 9016665) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 9016665 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | CC(C)NC(=O)CNC(=O)COC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H25N3O4/c1-13(2)22-17(23)11-21-18(24)12-26-19(25)9-5-6-14-10-20-16-8-4-3-7-15(14)16/h3-4,7-8,10,13,20H,5-6,9,11-12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | KWDKAHLULXKMHU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |