C17H22N2O3 — CID 7169307
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate (PubChem CID 7169307) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 7169307 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2O3/c1-3-12(2)19-16(20)11-22-17(21)9-8-13-10-18-15-7-5-4-6-14(13)15/h4-7,10,12,18H,3,8-9,11H2,1-2H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | DFDNCHQEJISSFE-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |