C19H26N2O3 — CID 7659140
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 7659140) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7659140 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | CC(C)[C@@H](C)NC(=O)COC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H26N2O3/c1-13(2)14(3)21-18(22)12-24-19(23)10-6-7-15-11-20-17-9-5-4-8-16(15)17/h4-5,8-9,11,13-14,20H,6-7,10,12H2,1-3H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | HOTRCKTUVXRVBW-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |