C23H24N2O5 — CID 7662484
ethyl 2-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]benzoate (PubChem CID 7662484) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7662484 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl 2-[[2-[4-(1H-indol-3-yl)butanoyloxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24N2O5/c1-2-29-23(28)18-10-4-6-12-20(18)25-21(26)15-30-22(27)13-7-8-16-14-24-19-11-5-3-9-17(16)19/h3-6,9-12,14,24H,2,7-8,13,15H2,1H3,(H,25,26) |
| InChIKey | LDPNYPXAEZZXRW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |