C20H27NO3 — CID 58248748
ethyl 10-(1H-indol-3-yl)-7-oxodecanoate (PubChem CID 58248748) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethyl 10-(1H-indol-3-yl)-7-oxodecanoate.
| Compound Name | ethyl 10-(1H-indol-3-yl)-7-oxodecanoate |
|---|---|
| PubChem CID | 58248748 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethyl 10-(1H-indol-3-yl)-7-oxodecanoate |
| SMILES | CCOC(=O)CCCCCC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H27NO3/c1-2-24-20(23)14-5-3-4-10-17(22)11-8-9-16-15-21-19-13-7-6-12-18(16)19/h6-7,12-13,15,21H,2-5,8-11,14H2,1H3 |
| InChIKey | DLVKRIPSLXODIO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|