C19H25NO3 — CID 58248576
1-hydroxy-11-(1H-indol-3-yl)undecane-2,8-dione (PubChem CID 58248576) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-hydroxy-11-(1H-indol-3-yl)undecane-2,8-dione.
| Compound Name | 1-hydroxy-11-(1H-indol-3-yl)undecane-2,8-dione |
|---|---|
| PubChem CID | 58248576 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-hydroxy-11-(1H-indol-3-yl)undecane-2,8-dione |
| SMILES | O=C(CO)CCCCCC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H25NO3/c21-14-17(23)9-3-1-2-8-16(22)10-6-7-15-13-20-19-12-5-4-11-18(15)19/h4-5,11-13,20-21H,1-3,6-10,14H2 |
| InChIKey | ZWRMNKSHOSVOSI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|