About S-amino 4-(1H-indol-3-yl)butanethioate
S-amino 4-(1H-indol-3-yl)butanethioate (PubChem CID 87254354) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is S-amino 4-(1H-indol-3-yl)butanethioate.
Molecular Properties
| Compound Name | S-amino 4-(1H-indol-3-yl)butanethioate |
| PubChem CID | 87254354 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | S-amino 4-(1H-indol-3-yl)butanethioate |
| SMILES | NSC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H14N2OS/c13-16-12(15)7-3-4-9-8-14-11-6-2-1-5-10(9)11/h1-2,5-6,8,14H,3-4,7,13H2 |
| InChIKey | XKURNNAQEMFDCU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-amino 4-(1H-indol-3-yl)butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-amino 4-(1H-indol-3-yl)butanethioate?
The IUPAC name of S-amino 4-(1H-indol-3-yl)butanethioate (CID 87254354) is S-amino 4-(1H-indol-3-yl)butanethioate.
What is the SMILES notation for S-amino 4-(1H-indol-3-yl)butanethioate?
The canonical SMILES for S-amino 4-(1H-indol-3-yl)butanethioate is NSC(=O)CCCc1c[nH]c2ccccc12.
What is the InChIKey of S-amino 4-(1H-indol-3-yl)butanethioate?
The InChIKey is XKURNNAQEMFDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c13-16-12(15)7-3-4-9-8-14-11-6-2-1-5-10(9)11/h1-2,5-6,8,14H,3-4,7,13H2.
What are the key properties of S-amino 4-(1H-indol-3-yl)butanethioate?
S-amino 4-(1H-indol-3-yl)butanethioate has a molecular weight of 234.32 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-amino 4-(1H-indol-3-yl)butanethioate is sourced from PubChem (CID 87254354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).