C22H22N4O2 — CID 29437828
4-(1H-indol-3-yl)-N'-[2-(1H-indol-3-yl)acetyl]butanehydrazide (PubChem CID 29437828) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N'-[2-(1H-indol-3-yl)acetyl]butanehydrazide.
| Compound Name | 4-(1H-indol-3-yl)-N'-[2-(1H-indol-3-yl)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 29437828 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-(1H-indol-3-yl)-N'-[2-(1H-indol-3-yl)acetyl]butanehydrazide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H22N4O2/c27-21(11-5-6-15-13-23-19-9-3-1-7-17(15)19)25-26-22(28)12-16-14-24-20-10-4-2-8-18(16)20/h1-4,7-10,13-14,23-24H,5-6,11-12H2,(H,25,27)(H,26,28) |
| InChIKey | KZGCQDJRBYNVTI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|