C25H28N4O2 — CID 42506947
4-(1H-indol-3-yl)-N-[2-[3-(1H-indol-3-yl)propanoylamino]ethyl]butanamide (PubChem CID 42506947) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[2-[3-(1H-indol-3-yl)propanoylamino]ethyl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[2-[3-(1H-indol-3-yl)propanoylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 42506947 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[2-[3-(1H-indol-3-yl)propanoylamino]ethyl]butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCCNC(=O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H28N4O2/c30-24(11-5-6-18-16-28-22-9-3-1-7-20(18)22)26-14-15-27-25(31)13-12-19-17-29-23-10-4-2-8-21(19)23/h1-4,7-10,16-17,28-29H,5-6,11-15H2,(H,26,30)(H,27,31) |
| InChIKey | SSWJVUYUBWFXBV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|