C22H22F3N3O2 — CID 55545954
N-[2-[4-(1H-indol-3-yl)butanoylamino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 55545954) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-[2-[4-(1H-indol-3-yl)butanoylamino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-(1H-indol-3-yl)butanoylamino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55545954 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[2-[4-(1H-indol-3-yl)butanoylamino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3N3O2/c23-22(24,25)17-10-8-15(9-11-17)21(30)27-13-12-26-20(29)7-3-4-16-14-28-19-6-2-1-5-18(16)19/h1-2,5-6,8-11,14,28H,3-4,7,12-13H2,(H,26,29)(H,27,30) |
| InChIKey | DETBEYAHFKHTGZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|