C17H25N3O — CID 43601757
N-[3-(ethylamino)propyl]-4-(1H-indol-3-yl)butanamide (PubChem CID 43601757) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[3-(ethylamino)propyl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[3-(ethylamino)propyl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 43601757 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-[3-(ethylamino)propyl]-4-(1H-indol-3-yl)butanamide |
| SMILES | CCNCCCNC(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H25N3O/c1-2-18-11-6-12-19-17(21)10-5-7-14-13-20-16-9-4-3-8-15(14)16/h3-4,8-9,13,18,20H,2,5-7,10-12H2,1H3,(H,19,21) |
| InChIKey | OFKAVGQIYDRFSG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|