C23H29N3O — CID 55452531
N-[3-(N-ethylanilino)propyl]-4-(1H-indol-3-yl)butanamide (PubChem CID 55452531) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-4-(1H-indol-3-yl)butanamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-4-(1H-indol-3-yl)butanamide |
|---|---|
| PubChem CID | 55452531 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-4-(1H-indol-3-yl)butanamide |
| SMILES | CCN(CCCNC(=O)CCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O/c1-2-26(20-11-4-3-5-12-20)17-9-16-24-23(27)15-8-10-19-18-25-22-14-7-6-13-21(19)22/h3-7,11-14,18,25H,2,8-10,15-17H2,1H3,(H,24,27) |
| InChIKey | XUXUJGYDBRLHDU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|