C28H36N4O4 — CID 172871952
(E)-but-2-enedioic acid;bis(N-ethyl-2-(1H-indol-3-yl)ethanamine) (PubChem CID 172871952) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(N-ethyl-2-(1H-indol-3-yl)ethanamine).
| Compound Name | (E)-but-2-enedioic acid;bis(N-ethyl-2-(1H-indol-3-yl)ethanamine) |
|---|---|
| PubChem CID | 172871952 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(N-ethyl-2-(1H-indol-3-yl)ethanamine) |
| SMILES | CCNCCc1c[nH]c2ccccc12.CCNCCc1c[nH]c2ccccc12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C12H16N2.C4H4O4/c2*1-2-13-8-7-10-9-14-12-6-4-3-5-11(10)12;5-3(6)1-2-4(7)8/h2*3-6,9,13-14H,2,7-8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | ITTRDEKQBZIZTI-WXXKFALUSA-N |
| XLogP | 4.35 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|