C17H22N2O4 — CID 5380391
(Z)-but-2-enedioic acid;N-[2-(1H-indol-3-yl)ethyl]propan-2-amine (PubChem CID 5380391) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[2-(1H-indol-3-yl)ethyl]propan-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;N-[2-(1H-indol-3-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 5380391 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[2-(1H-indol-3-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1c[nH]c2ccccc12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H18N2.C4H4O4/c1-10(2)14-8-7-11-9-15-13-6-4-3-5-12(11)13;5-3(6)1-2-4(7)8/h3-6,9-10,14-15H,7-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CKRYLZSOJYTSQF-BTJKTKAUSA-N |
| XLogP | 2.42 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|