C20H23N3O — CID 40938355
(2R)-2-[2-(1H-indol-3-yl)ethylamino]-N,N-dimethyl-2-phenylacetamide (PubChem CID 40938355) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R)-2-[2-(1H-indol-3-yl)ethylamino]-N,N-dimethyl-2-phenylacetamide.
| Compound Name | (2R)-2-[2-(1H-indol-3-yl)ethylamino]-N,N-dimethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 40938355 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2R)-2-[2-(1H-indol-3-yl)ethylamino]-N,N-dimethyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)[C@H](NCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O/c1-23(2)20(24)19(15-8-4-3-5-9-15)21-13-12-16-14-22-18-11-7-6-10-17(16)18/h3-11,14,19,21-22H,12-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | JZGWWMMDCDIQEF-LJQANCHMSA-N |
| XLogP | 3.13 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |