C18H26N2O2 — CID 174620908
2-(3,3-dimethylbutylamino)-4-(1H-indol-3-yl)butanoic acid (PubChem CID 174620908) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylamino)-4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 2-(3,3-dimethylbutylamino)-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 174620908 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-(3,3-dimethylbutylamino)-4-(1H-indol-3-yl)butanoic acid |
| SMILES | CC(C)(C)CCNC(CCc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H26N2O2/c1-18(2,3)10-11-19-16(17(21)22)9-8-13-12-20-15-7-5-4-6-14(13)15/h4-7,12,16,19-20H,8-11H2,1-3H3,(H,21,22) |
| InChIKey | XHEPAGIMROMBIN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |