C21H23N3O3 — CID 16585471
2-[2-(1H-indol-3-yl)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid (PubChem CID 16585471) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid.
| Compound Name | 2-[2-(1H-indol-3-yl)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 16585471 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(NC(=O)CC(NCCc2c[nH]c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-14-6-8-16(9-7-14)24-20(25)12-19(21(26)27)22-11-10-15-13-23-18-5-3-2-4-17(15)18/h2-9,13,19,22-23H,10-12H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | CDELLVJSKWWZRP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |