C26H24N2O2S — CID 155021919
(2S)-3-(1H-indol-3-yl)-2-[2-[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]ethylamino]propanoic acid (PubChem CID 155021919) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[2-[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]ethylamino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[2-[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 155021919 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[2-[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]ethylamino]propanoic acid |
| SMILES | Cc1ccc(C#Cc2ccc(CCN[C@@H](Cc3c[nH]c4ccccc34)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C26H24N2O2S/c1-18-6-8-19(9-7-18)10-11-21-12-13-22(31-21)14-15-27-25(26(29)30)16-20-17-28-24-5-3-2-4-23(20)24/h2-9,12-13,17,25,27-28H,14-16H2,1H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | ZOGIIBNEEDJVMD-VWLOTQADSA-N |
| XLogP | 4.77 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|