C24H19BN2O4S2 — CID 154660254
CID 154660254 (PubChem CID 154660254) has the molecular formula C24H19BN2O4S2 and a molecular weight of 474.37 g/mol.
| Compound Name | CID 154660254 |
|---|---|
| PubChem CID | 154660254 |
| Molecular Formula | C24H19BN2O4S2 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(C[C@@H](NS(=O)(=O)c3ccc(C#Cc4ccc(C)cc4)s3)C(=O)O)c[nH]c2c1 |
| InChI | InChI=1S/C24H19BN2O4S2/c1-15-2-4-16(5-3-15)6-8-19-9-11-23(32-19)33(30,31)27-22(24(28)29)12-17-14-26-21-13-18(25)7-10-20(17)21/h2-5,7,9-11,13-14,22,26-27H,12H2,1H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | WHEMEBNREROULG-JOCHJYFZSA-N |
| XLogP | 2.71 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|