C24H20N2O4S2 — CID 46842874
(2S)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-(2,5,7-trideuterio-1H-indol-3-yl)propanoic acid (PubChem CID 46842874) has the molecular formula C24H20N2O4S2 and a molecular weight of 467.59 g/mol. Its IUPAC name is (2S)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-(2,5,7-trideuterio-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-(2,5,7-trideuterio-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 46842874 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (2S)-2-[[5-[2-(4-methylphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-3-(2,5,7-trideuterio-1H-indol-3-yl)propanoic acid |
| SMILES | [2H]c1cc([2H])c2[nH]c([2H])c(C[C@H](NS(=O)(=O)c3ccc(C#Cc4ccc(C)cc4)s3)C(=O)O)c2c1 |
| InChI | InChI=1S/C24H20N2O4S2/c1-16-6-8-17(9-7-16)10-11-19-12-13-23(31-19)32(29,30)26-22(24(27)28)14-18-15-25-21-5-3-2-4-20(18)21/h2-9,12-13,15,22,25-26H,14H2,1H3,(H,27,28)/t22-/m0/s1/i2D,5D,15D |
| InChIKey | YWCLDDLVLSQGSZ-SEBDTQPOSA-N |
| XLogP | 3.91 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|