C24H19NO5S2 — CID 10814028
2-[[5-[2-(4-methoxyphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-5-phenylpent-4-ynoic acid (PubChem CID 10814028) has the molecular formula C24H19NO5S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[[5-[2-(4-methoxyphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-5-phenylpent-4-ynoic acid.
| Compound Name | 2-[[5-[2-(4-methoxyphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-5-phenylpent-4-ynoic acid |
|---|---|
| PubChem CID | 10814028 |
| Molecular Formula | C24H19NO5S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 2-[[5-[2-(4-methoxyphenyl)ethynyl]thiophen-2-yl]sulfonylamino]-5-phenylpent-4-ynoic acid |
| SMILES | COc1ccc(C#Cc2ccc(S(=O)(=O)NC(CC#Cc3ccccc3)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C24H19NO5S2/c1-30-20-13-10-19(11-14-20)12-15-21-16-17-23(31-21)32(28,29)25-22(24(26)27)9-5-8-18-6-3-2-4-7-18/h2-4,6-7,10-11,13-14,16-17,22,25H,9H2,1H3,(H,26,27) |
| InChIKey | ZSZSGGNFCMWYDF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|