C24H20N2O4S2 — CID 90260538
(2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylamino]butanoic acid (PubChem CID 90260538) has the molecular formula C24H20N2O4S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylamino]butanoic acid.
| Compound Name | (2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 90260538 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylamino]butanoic acid |
| SMILES | C[C@@H](c1c[nH]c2ccccc12)[C@@H](NS(=O)(=O)c1ccc(C#Cc2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C24H20N2O4S2/c1-16(20-15-25-21-10-6-5-9-19(20)21)23(24(27)28)26-32(29,30)22-14-13-18(31-22)12-11-17-7-3-2-4-8-17/h2-10,13-16,23,25-26H,1H3,(H,27,28)/t16-,23+/m0/s1 |
| InChIKey | CDRFCXIFGWMYFJ-QMHKHESXSA-N |
| XLogP | 4.16 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|