C23H18F3N2O5PS2 — CID 46840481
[(1R)-2-(1H-indol-3-yl)-1-[[5-[2-[4-(trifluoromethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]ethyl]phosphonic acid (PubChem CID 46840481) has the molecular formula C23H18F3N2O5PS2 and a molecular weight of 554.51 g/mol. Its IUPAC name is [(1R)-2-(1H-indol-3-yl)-1-[[5-[2-[4-(trifluoromethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]ethyl]phosphonic acid.
| Compound Name | [(1R)-2-(1H-indol-3-yl)-1-[[5-[2-[4-(trifluoromethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 46840481 |
| Molecular Formula | C23H18F3N2O5PS2 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.03 |
| IUPAC Name | [(1R)-2-(1H-indol-3-yl)-1-[[5-[2-[4-(trifluoromethyl)phenyl]ethynyl]thiophen-2-yl]sulfonylamino]ethyl]phosphonic acid |
| SMILES | O=P(O)(O)[C@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(C#Cc2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C23H18F3N2O5PS2/c24-23(25,26)17-8-5-15(6-9-17)7-10-18-11-12-22(35-18)36(32,33)28-21(34(29,30)31)13-16-14-27-20-4-2-1-3-19(16)20/h1-6,8-9,11-12,14,21,27-28H,13H2,(H2,29,30,31)/t21-/m1/s1 |
| InChIKey | KUZGTDKEMOFFAR-OAQYLSRUSA-N |
| XLogP | 4.67 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|