C19H17F3N2O2 — CID 68812625
3-(1H-indol-3-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]propanoic acid (PubChem CID 68812625) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 68812625 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[[4-(trifluoromethyl)phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)14-7-5-12(6-8-14)10-23-17(18(25)26)9-13-11-24-16-4-2-1-3-15(13)16/h1-8,11,17,23-24H,9-10H2,(H,25,26) |
| InChIKey | JRFKVRKRUYLSQZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |