C27H22F6N4O6 — CID 16760931
2-[[5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 16760931) has the molecular formula C27H22F6N4O6 and a molecular weight of 612.48 g/mol. Its IUPAC name is 2-[[5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 16760931 |
| Molecular Formula | C27H22F6N4O6 |
| Molecular Weight | 612.48 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | 2-[[5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H22F6N4O6/c28-25(29,23(42)36-19(21(38)39)9-13-11-34-17-7-3-1-5-15(13)17)27(32,33)26(30,31)24(43)37-20(22(40)41)10-14-12-35-18-8-4-2-6-16(14)18/h1-8,11-12,19-20,34-35H,9-10H2,(H,36,42)(H,37,43)(H,38,39)(H,40,41) |
| InChIKey | RSACXXGOTLKZHK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|