C24H21N3O3 — CID 4530624
2-(diphenylcarbamoylamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 4530624) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(diphenylcarbamoylamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-(diphenylcarbamoylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 4530624 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-(diphenylcarbamoylamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O3/c28-23(29)22(15-17-16-25-21-14-8-7-13-20(17)21)26-24(30)27(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-14,16,22,25H,15H2,(H,26,30)(H,28,29) |
| InChIKey | DPIKOWRJRJDXBN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |