C20H20N2O3 — CID 74988650
2-[(2,6-dimethylbenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 74988650) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[(2,6-dimethylbenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[(2,6-dimethylbenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 74988650 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[(2,6-dimethylbenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | Cc1cccc(C)c1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H20N2O3/c1-12-6-5-7-13(2)18(12)19(23)22-17(20(24)25)10-14-11-21-16-9-4-3-8-15(14)16/h3-9,11,17,21H,10H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | DEGQRJCTRCTPIT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |