C14H13F3N2O3 — CID 16771664
3-(1H-indol-3-yl)-2-(3,3,3-trifluoropropanoylamino)propanoic acid (PubChem CID 16771664) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-(3,3,3-trifluoropropanoylamino)propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-(3,3,3-trifluoropropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 16771664 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-(3,3,3-trifluoropropanoylamino)propanoic acid |
| SMILES | O=C(CC(F)(F)F)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H13F3N2O3/c15-14(16,17)6-12(20)19-11(13(21)22)5-8-7-18-10-4-2-1-3-9(8)10/h1-4,7,11,18H,5-6H2,(H,19,20)(H,21,22) |
| InChIKey | AFVUISHQXSACOZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |