C19H16Cl2N2O3 — CID 19785881
2-[[2-(2,6-dichlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 19785881) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 2-[[2-(2,6-dichlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-(2,6-dichlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 19785881 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-[[2-(2,6-dichlorophenyl)acetyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H16Cl2N2O3/c20-14-5-3-6-15(21)13(14)9-18(24)23-17(19(25)26)8-11-10-22-16-7-2-1-4-12(11)16/h1-7,10,17,22H,8-9H2,(H,23,24)(H,25,26) |
| InChIKey | IXIACTWRBPXTFE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |