C19H17ClFN3O3 — CID 51519517
(2R)-2-[(2-chloro-6-fluorophenyl)methylcarbamoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 51519517) has the molecular formula C19H17ClFN3O3 and a molecular weight of 389.81 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-6-fluorophenyl)methylcarbamoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[(2-chloro-6-fluorophenyl)methylcarbamoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 51519517 |
| Molecular Formula | C19H17ClFN3O3 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (2R)-2-[(2-chloro-6-fluorophenyl)methylcarbamoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(NCc1c(F)cccc1Cl)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H17ClFN3O3/c20-14-5-3-6-15(21)13(14)10-23-19(27)24-17(18(25)26)8-11-9-22-16-7-2-1-4-12(11)16/h1-7,9,17,22H,8,10H2,(H,25,26)(H2,23,24,27)/t17-/m1/s1 |
| InChIKey | OQWGQDDTPGRVJM-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |