C19H18N2O2S — CID 88772497
3-(1H-indol-3-yl)-2-[(2-phenylethanethioyl)amino]propanoic acid (PubChem CID 88772497) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[(2-phenylethanethioyl)amino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[(2-phenylethanethioyl)amino]propanoic acid |
|---|---|
| PubChem CID | 88772497 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[(2-phenylethanethioyl)amino]propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)NC(=S)Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2S/c22-19(23)17(21-18(24)10-13-6-2-1-3-7-13)11-14-12-20-16-9-5-4-8-15(14)16/h1-9,12,17,20H,10-11H2,(H,21,24)(H,22,23) |
| InChIKey | PYKXXWHASYWKCN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|