C19H18N2O2S2 — CID 13209097
(2S)-2-(benzylsulfanylcarbothioylamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 13209097) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (2S)-2-(benzylsulfanylcarbothioylamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-(benzylsulfanylcarbothioylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 13209097 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (2S)-2-(benzylsulfanylcarbothioylamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1c[nH]c2ccccc12)NC(=S)SCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2S2/c22-18(23)17(10-14-11-20-16-9-5-4-8-15(14)16)21-19(24)25-12-13-6-2-1-3-7-13/h1-9,11,17,20H,10,12H2,(H,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | BRVDGDMTDDUYAE-KRWDZBQOSA-N |
| XLogP | 3.97 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|