C15H14N2O3 — CID 107986994
(2R)-2-(but-2-ynoylamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 107986994) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (2R)-2-(but-2-ynoylamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-(but-2-ynoylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 107986994 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2R)-2-(but-2-ynoylamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC#CC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H14N2O3/c1-2-5-14(18)17-13(15(19)20)8-10-9-16-12-7-4-3-6-11(10)12/h3-4,6-7,9,13,16H,8H2,1H3,(H,17,18)(H,19,20)/t13-/m1/s1 |
| InChIKey | PFHRYUOIJNYBQC-CYBMUJFWSA-N |
| XLogP | 1.30 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|