C21H24N2O5 — CID 51997757
(2S)-3-(1H-indol-3-yl)-2-[(3,4,5-trimethoxyphenyl)methylamino]propanoic acid (PubChem CID 51997757) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[(3,4,5-trimethoxyphenyl)methylamino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[(3,4,5-trimethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 51997757 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[(3,4,5-trimethoxyphenyl)methylamino]propanoic acid |
| SMILES | COc1cc(CN[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O5/c1-26-18-8-13(9-19(27-2)20(18)28-3)11-22-17(21(24)25)10-14-12-23-16-7-5-4-6-15(14)16/h4-9,12,17,22-23H,10-11H2,1-3H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | IAVZBWVHOHLVAE-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |