C24H28N2O4 — CID 17213426
2-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 17213426) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 17213426 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | C=CCc1cc(CNC(Cc2c[nH]c3ccccc23)C(=O)O)cc(OC)c1OCC |
| InChI | InChI=1S/C24H28N2O4/c1-4-8-17-11-16(12-22(29-3)23(17)30-5-2)14-25-21(24(27)28)13-18-15-26-20-10-7-6-9-19(18)20/h4,6-7,9-12,15,21,25-26H,1,5,8,13-14H2,2-3H3,(H,27,28) |
| InChIKey | AKQGRCRKHRYVRH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|