C25H21NO4S2 — CID 58478563
(2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylmethyl]butanoic acid (PubChem CID 58478563) has the molecular formula C25H21NO4S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylmethyl]butanoic acid.
| Compound Name | (2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylmethyl]butanoic acid |
|---|---|
| PubChem CID | 58478563 |
| Molecular Formula | C25H21NO4S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (2R,3S)-3-(1H-indol-3-yl)-2-[[5-(2-phenylethynyl)thiophen-2-yl]sulfonylmethyl]butanoic acid |
| SMILES | C[C@H](c1c[nH]c2ccccc12)C(CS(=O)(=O)c1ccc(C#Cc2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C25H21NO4S2/c1-17(21-15-26-23-10-6-5-9-20(21)23)22(25(27)28)16-32(29,30)24-14-13-19(31-24)12-11-18-7-3-2-4-8-18/h2-10,13-15,17,22,26H,16H2,1H3,(H,27,28)/t17-,22?/m1/s1 |
| InChIKey | LCCAGWJVWHBOCY-PLEWWHCXSA-N |
| XLogP | 4.91 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|